About 1-(3-chlorophenyl)-5-(2,4-difluorophenyl)-4,5-dihydroimidazol-2-amine
1-(3-chlorophenyl)-5-(2,4-difluorophenyl)-4,5-dihydroimidazol-2-amine (PubChem CID 79500440) has the molecular formula C15H12ClF2N3
and a molecular weight of 307.73 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-5-(2,4-difluorophenyl)-4,5-dihydroimidazol-2-amine.
Molecular Properties
| Compound Name | 1-(3-chlorophenyl)-5-(2,4-difluorophenyl)-4,5-dihydroimidazol-2-amine |
| PubChem CID | 79500440 |
| Molecular Formula | C15H12ClF2N3 |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 1-(3-chlorophenyl)-5-(2,4-difluorophenyl)-4,5-dihydroimidazol-2-amine |
| SMILES | NC1=NCC(c2ccc(F)cc2F)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H12ClF2N3/c16-9-2-1-3-11(6-9)21-14(8-20-15(21)19)12-5-4-10(17)7-13(12)18/h1-7,14H,8H2,(H2,19,20) |
| InChIKey | KHDYVONELVGSFY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-chlorophenyl)-5-(2,4-difluorophenyl)-4,5-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chlorophenyl)-5-(2,4-difluorophenyl)-4,5-dihydroimidazol-2-amine?
The IUPAC name of 1-(3-chlorophenyl)-5-(2,4-difluorophenyl)-4,5-dihydroimidazol-2-amine (CID 79500440) is 1-(3-chlorophenyl)-5-(2,4-difluorophenyl)-4,5-dihydroimidazol-2-amine.
What is the SMILES notation for 1-(3-chlorophenyl)-5-(2,4-difluorophenyl)-4,5-dihydroimidazol-2-amine?
The canonical SMILES for 1-(3-chlorophenyl)-5-(2,4-difluorophenyl)-4,5-dihydroimidazol-2-amine is NC1=NCC(c2ccc(F)cc2F)N1c1cccc(Cl)c1.
What is the InChIKey of 1-(3-chlorophenyl)-5-(2,4-difluorophenyl)-4,5-dihydroimidazol-2-amine?
The InChIKey is KHDYVONELVGSFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClF2N3/c16-9-2-1-3-11(6-9)21-14(8-20-15(21)19)12-5-4-10(17)7-13(12)18/h1-7,14H,8H2,(H2,19,20).
What are the key properties of 1-(3-chlorophenyl)-5-(2,4-difluorophenyl)-4,5-dihydroimidazol-2-amine?
1-(3-chlorophenyl)-5-(2,4-difluorophenyl)-4,5-dihydroimidazol-2-amine has a molecular weight of 307.73 g/mol, XLogP of 3.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chlorophenyl)-5-(2,4-difluorophenyl)-4,5-dihydroimidazol-2-amine is sourced from PubChem (CID 79500440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).