About 5-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)furan-2-carboxamide
5-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)furan-2-carboxamide (PubChem CID 795005) has the molecular formula C13H9BrN2O2S
and a molecular weight of 337.20 g/mol. Its IUPAC name is 5-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)furan-2-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)furan-2-carboxamide |
| PubChem CID | 795005 |
| Molecular Formula | C13H9BrN2O2S |
| Molecular Weight | 337.20 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 5-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)furan-2-carboxamide |
| SMILES | Cc1ccc2nc(NC(=O)c3ccc(Br)o3)sc2c1 |
| InChI | InChI=1S/C13H9BrN2O2S/c1-7-2-3-8-10(6-7)19-13(15-8)16-12(17)9-4-5-11(14)18-9/h2-6H,1H3,(H,15,16,17) |
| InChIKey | HGFPAJKGVAMTFY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.20 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)furan-2-carboxamide?
The IUPAC name of 5-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)furan-2-carboxamide (CID 795005) is 5-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)furan-2-carboxamide.
What is the SMILES notation for 5-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)furan-2-carboxamide?
The canonical SMILES for 5-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)furan-2-carboxamide is Cc1ccc2nc(NC(=O)c3ccc(Br)o3)sc2c1.
What is the InChIKey of 5-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)furan-2-carboxamide?
The InChIKey is HGFPAJKGVAMTFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrN2O2S/c1-7-2-3-8-10(6-7)19-13(15-8)16-12(17)9-4-5-11(14)18-9/h2-6H,1H3,(H,15,16,17).
What are the key properties of 5-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)furan-2-carboxamide?
5-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)furan-2-carboxamide has a molecular weight of 337.20 g/mol, XLogP of 4.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(6-methyl-1,3-benzothiazol-2-yl)furan-2-carboxamide is sourced from PubChem (CID 795005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).