C16H16BrN3O — CID 79500908
1-(2-bromophenyl)-5-(4-methoxyphenyl)-4,5-dihydroimidazol-2-amine (PubChem CID 79500908) has the molecular formula C16H16BrN3O and a molecular weight of 346.23 g/mol. Its IUPAC name is 1-(2-bromophenyl)-5-(4-methoxyphenyl)-4,5-dihydroimidazol-2-amine.
| Compound Name | 1-(2-bromophenyl)-5-(4-methoxyphenyl)-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 79500908 |
| Molecular Formula | C16H16BrN3O |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 1-(2-bromophenyl)-5-(4-methoxyphenyl)-4,5-dihydroimidazol-2-amine |
| SMILES | COc1ccc(C2CN=C(N)N2c2ccccc2Br)cc1 |
| InChI | InChI=1S/C16H16BrN3O/c1-21-12-8-6-11(7-9-12)15-10-19-16(18)20(15)14-5-3-2-4-13(14)17/h2-9,15H,10H2,1H3,(H2,18,19) |
| InChIKey | YLNSXOKGSOPAKI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |