C9H13N3O2 — CID 79501211
1-methyl-3-(1,2-oxazol-3-ylmethylamino)pyrrolidin-2-one (PubChem CID 79501211) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-methyl-3-(1,2-oxazol-3-ylmethylamino)pyrrolidin-2-one.
| Compound Name | 1-methyl-3-(1,2-oxazol-3-ylmethylamino)pyrrolidin-2-one |
|---|---|
| PubChem CID | 79501211 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 1-methyl-3-(1,2-oxazol-3-ylmethylamino)pyrrolidin-2-one |
| SMILES | CN1CCC(NCc2ccon2)C1=O |
| InChI | InChI=1S/C9H13N3O2/c1-12-4-2-8(9(12)13)10-6-7-3-5-14-11-7/h3,5,8,10H,2,4,6H2,1H3 |
| InChIKey | RPFTVXZSCURLEH-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |