About 8-(4-aminophenyl)-7,9-diazaspiro[4.5]dec-8-ene-6,10-dione
8-(4-aminophenyl)-7,9-diazaspiro[4.5]dec-8-ene-6,10-dione (PubChem CID 79501267) has the molecular formula C14H15N3O2
and a molecular weight of 257.29 g/mol. Its IUPAC name is 8-(4-aminophenyl)-7,9-diazaspiro[4.5]dec-8-ene-6,10-dione.
Molecular Properties
| Compound Name | 8-(4-aminophenyl)-7,9-diazaspiro[4.5]dec-8-ene-6,10-dione |
| PubChem CID | 79501267 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 8-(4-aminophenyl)-7,9-diazaspiro[4.5]dec-8-ene-6,10-dione |
| SMILES | Nc1ccc(C2=NC(=O)C3(CCCC3)C(=O)N2)cc1 |
| InChI | InChI=1S/C14H15N3O2/c15-10-5-3-9(4-6-10)11-16-12(18)14(13(19)17-11)7-1-2-8-14/h3-6H,1-2,7-8,15H2,(H,16,17,18,19) |
| InChIKey | JMWOTVMAGWGUBT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 8-(4-aminophenyl)-7,9-diazaspiro[4.5]dec-8-ene-6,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-aminophenyl)-7,9-diazaspiro[4.5]dec-8-ene-6,10-dione?
The IUPAC name of 8-(4-aminophenyl)-7,9-diazaspiro[4.5]dec-8-ene-6,10-dione (CID 79501267) is 8-(4-aminophenyl)-7,9-diazaspiro[4.5]dec-8-ene-6,10-dione.
What is the SMILES notation for 8-(4-aminophenyl)-7,9-diazaspiro[4.5]dec-8-ene-6,10-dione?
The canonical SMILES for 8-(4-aminophenyl)-7,9-diazaspiro[4.5]dec-8-ene-6,10-dione is Nc1ccc(C2=NC(=O)C3(CCCC3)C(=O)N2)cc1.
What is the InChIKey of 8-(4-aminophenyl)-7,9-diazaspiro[4.5]dec-8-ene-6,10-dione?
The InChIKey is JMWOTVMAGWGUBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O2/c15-10-5-3-9(4-6-10)11-16-12(18)14(13(19)17-11)7-1-2-8-14/h3-6H,1-2,7-8,15H2,(H,16,17,18,19).
What are the key properties of 8-(4-aminophenyl)-7,9-diazaspiro[4.5]dec-8-ene-6,10-dione?
8-(4-aminophenyl)-7,9-diazaspiro[4.5]dec-8-ene-6,10-dione has a molecular weight of 257.29 g/mol, XLogP of 1.23, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-aminophenyl)-7,9-diazaspiro[4.5]dec-8-ene-6,10-dione is sourced from PubChem (CID 79501267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).