About 3-(piperazin-1-ylmethyl)-1,2,5-thiadiazole
3-(piperazin-1-ylmethyl)-1,2,5-thiadiazole (PubChem CID 79501627) has the molecular formula C7H12N4S
and a molecular weight of 184.27 g/mol. Its IUPAC name is 3-(piperazin-1-ylmethyl)-1,2,5-thiadiazole.
Molecular Properties
| Compound Name | 3-(piperazin-1-ylmethyl)-1,2,5-thiadiazole |
| PubChem CID | 79501627 |
| Molecular Formula | C7H12N4S |
| Molecular Weight | 184.27 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 3-(piperazin-1-ylmethyl)-1,2,5-thiadiazole |
| SMILES | c1nsnc1CN1CCNCC1 |
| InChI | InChI=1S/C7H12N4S/c1-3-11(4-2-8-1)6-7-5-9-12-10-7/h5,8H,1-4,6H2 |
| InChIKey | RQNCRSPUYYSHCO-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.27 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(piperazin-1-ylmethyl)-1,2,5-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(piperazin-1-ylmethyl)-1,2,5-thiadiazole?
The IUPAC name of 3-(piperazin-1-ylmethyl)-1,2,5-thiadiazole (CID 79501627) is 3-(piperazin-1-ylmethyl)-1,2,5-thiadiazole.
What is the SMILES notation for 3-(piperazin-1-ylmethyl)-1,2,5-thiadiazole?
The canonical SMILES for 3-(piperazin-1-ylmethyl)-1,2,5-thiadiazole is c1nsnc1CN1CCNCC1.
What is the InChIKey of 3-(piperazin-1-ylmethyl)-1,2,5-thiadiazole?
The InChIKey is RQNCRSPUYYSHCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4S/c1-3-11(4-2-8-1)6-7-5-9-12-10-7/h5,8H,1-4,6H2.
What are the key properties of 3-(piperazin-1-ylmethyl)-1,2,5-thiadiazole?
3-(piperazin-1-ylmethyl)-1,2,5-thiadiazole has a molecular weight of 184.27 g/mol, XLogP of -0.06, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(piperazin-1-ylmethyl)-1,2,5-thiadiazole is sourced from PubChem (CID 79501627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).