About 6-(methylaminomethyl)-5,7-diazaspiro[2.5]oct-6-ene-4,8-dione
6-(methylaminomethyl)-5,7-diazaspiro[2.5]oct-6-ene-4,8-dione (PubChem CID 79501692) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is 6-(methylaminomethyl)-5,7-diazaspiro[2.5]oct-6-ene-4,8-dione.
Molecular Properties
| Compound Name | 6-(methylaminomethyl)-5,7-diazaspiro[2.5]oct-6-ene-4,8-dione |
| PubChem CID | 79501692 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 6-(methylaminomethyl)-5,7-diazaspiro[2.5]oct-6-ene-4,8-dione |
| SMILES | CNCC1=NC(=O)C2(CC2)C(=O)N1 |
| InChI | InChI=1S/C8H11N3O2/c1-9-4-5-10-6(12)8(2-3-8)7(13)11-5/h9H,2-4H2,1H3,(H,10,11,12,13) |
| InChIKey | WJQWSUOPDDVSAB-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 6-(methylaminomethyl)-5,7-diazaspiro[2.5]oct-6-ene-4,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(methylaminomethyl)-5,7-diazaspiro[2.5]oct-6-ene-4,8-dione?
The IUPAC name of 6-(methylaminomethyl)-5,7-diazaspiro[2.5]oct-6-ene-4,8-dione (CID 79501692) is 6-(methylaminomethyl)-5,7-diazaspiro[2.5]oct-6-ene-4,8-dione.
What is the SMILES notation for 6-(methylaminomethyl)-5,7-diazaspiro[2.5]oct-6-ene-4,8-dione?
The canonical SMILES for 6-(methylaminomethyl)-5,7-diazaspiro[2.5]oct-6-ene-4,8-dione is CNCC1=NC(=O)C2(CC2)C(=O)N1.
What is the InChIKey of 6-(methylaminomethyl)-5,7-diazaspiro[2.5]oct-6-ene-4,8-dione?
The InChIKey is WJQWSUOPDDVSAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-9-4-5-10-6(12)8(2-3-8)7(13)11-5/h9H,2-4H2,1H3,(H,10,11,12,13).
What are the key properties of 6-(methylaminomethyl)-5,7-diazaspiro[2.5]oct-6-ene-4,8-dione?
6-(methylaminomethyl)-5,7-diazaspiro[2.5]oct-6-ene-4,8-dione has a molecular weight of 181.19 g/mol, XLogP of -0.96, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(methylaminomethyl)-5,7-diazaspiro[2.5]oct-6-ene-4,8-dione is sourced from PubChem (CID 79501692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).