C11H8N4O2S — CID 79501919
2-amino-6-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5,7-dione (PubChem CID 79501919) has the molecular formula C11H8N4O2S and a molecular weight of 260.28 g/mol. Its IUPAC name is 2-amino-6-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5,7-dione.
| Compound Name | 2-amino-6-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 79501919 |
| Molecular Formula | C11H8N4O2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-amino-6-phenyl-[1,3,4]thiadiazolo[3,2-a]pyrimidine-5,7-dione |
| SMILES | NC1=NN2C(=O)C(c3ccccc3)C(=O)N=C2S1 |
| InChI | InChI=1S/C11H8N4O2S/c12-10-14-15-9(17)7(6-4-2-1-3-5-6)8(16)13-11(15)18-10/h1-5,7H,(H2,12,14) |
| InChIKey | CYQCYNPADBHQSB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|