C12H12FN3O2 — CID 79502012
2-(2-aminoethyl)-5-(2-fluorophenyl)-1H-pyrimidine-4,6-dione (PubChem CID 79502012) has the molecular formula C12H12FN3O2 and a molecular weight of 249.24 g/mol. Its IUPAC name is 2-(2-aminoethyl)-5-(2-fluorophenyl)-1H-pyrimidine-4,6-dione.
| Compound Name | 2-(2-aminoethyl)-5-(2-fluorophenyl)-1H-pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 79502012 |
| Molecular Formula | C12H12FN3O2 |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 2-(2-aminoethyl)-5-(2-fluorophenyl)-1H-pyrimidine-4,6-dione |
| SMILES | NCCC1=NC(=O)C(c2ccccc2F)C(=O)N1 |
| InChI | InChI=1S/C12H12FN3O2/c13-8-4-2-1-3-7(8)10-11(17)15-9(5-6-14)16-12(10)18/h1-4,10H,5-6,14H2,(H,15,16,17,18) |
| InChIKey | RCXJGCJDAKJTOT-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|