C10H17N3O2 — CID 79502023
2-(2-aminobutan-2-yl)-5,5-dimethyl-1H-pyrimidine-4,6-dione (PubChem CID 79502023) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-(2-aminobutan-2-yl)-5,5-dimethyl-1H-pyrimidine-4,6-dione.
| Compound Name | 2-(2-aminobutan-2-yl)-5,5-dimethyl-1H-pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 79502023 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 2-(2-aminobutan-2-yl)-5,5-dimethyl-1H-pyrimidine-4,6-dione |
| SMILES | CCC(C)(N)C1=NC(=O)C(C)(C)C(=O)N1 |
| InChI | InChI=1S/C10H17N3O2/c1-5-10(4,11)6-12-7(14)9(2,3)8(15)13-6/h5,11H2,1-4H3,(H,12,13,14,15) |
| InChIKey | WLYBFCRNHCBWCW-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|