About N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,2-oxazole-3-carboxamide
N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,2-oxazole-3-carboxamide (PubChem CID 79503318) has the molecular formula C8H7N5O2S
and a molecular weight of 237.24 g/mol. Its IUPAC name is N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 79503318 |
| Molecular Formula | C8H7N5O2S |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,2-oxazole-3-carboxamide |
| SMILES | NC(=S)c1cn[nH]c1NC(=O)c1ccon1 |
| InChI | InChI=1S/C8H7N5O2S/c9-6(16)4-3-10-12-7(4)11-8(14)5-1-2-15-13-5/h1-3H,(H2,9,16)(H2,10,11,12,14) |
| InChIKey | VHPJWPIZPHZTTP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,2-oxazole-3-carboxamide?
The IUPAC name of N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,2-oxazole-3-carboxamide (CID 79503318) is N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,2-oxazole-3-carboxamide is NC(=S)c1cn[nH]c1NC(=O)c1ccon1.
What is the InChIKey of N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,2-oxazole-3-carboxamide?
The InChIKey is VHPJWPIZPHZTTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5O2S/c9-6(16)4-3-10-12-7(4)11-8(14)5-1-2-15-13-5/h1-3H,(H2,9,16)(H2,10,11,12,14).
What are the key properties of N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,2-oxazole-3-carboxamide?
N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,2-oxazole-3-carboxamide has a molecular weight of 237.24 g/mol, XLogP of 0.28, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 79503318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).