About 2-(3,4-dihydro-2H-pyrrol-5-ylamino)propane-1,3-diol
2-(3,4-dihydro-2H-pyrrol-5-ylamino)propane-1,3-diol (PubChem CID 79503345) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-pyrrol-5-ylamino)propane-1,3-diol.
Molecular Properties
| Compound Name | 2-(3,4-dihydro-2H-pyrrol-5-ylamino)propane-1,3-diol |
| PubChem CID | 79503345 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-(3,4-dihydro-2H-pyrrol-5-ylamino)propane-1,3-diol |
| SMILES | OCC(CO)NC1=NCCC1 |
| InChI | InChI=1S/C7H14N2O2/c10-4-6(5-11)9-7-2-1-3-8-7/h6,10-11H,1-5H2,(H,8,9) |
| InChIKey | OVDAGNYMUJTVLX-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-dihydro-2H-pyrrol-5-ylamino)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydro-2H-pyrrol-5-ylamino)propane-1,3-diol?
The IUPAC name of 2-(3,4-dihydro-2H-pyrrol-5-ylamino)propane-1,3-diol (CID 79503345) is 2-(3,4-dihydro-2H-pyrrol-5-ylamino)propane-1,3-diol.
What is the SMILES notation for 2-(3,4-dihydro-2H-pyrrol-5-ylamino)propane-1,3-diol?
The canonical SMILES for 2-(3,4-dihydro-2H-pyrrol-5-ylamino)propane-1,3-diol is OCC(CO)NC1=NCCC1.
What is the InChIKey of 2-(3,4-dihydro-2H-pyrrol-5-ylamino)propane-1,3-diol?
The InChIKey is OVDAGNYMUJTVLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c10-4-6(5-11)9-7-2-1-3-8-7/h6,10-11H,1-5H2,(H,8,9).
What are the key properties of 2-(3,4-dihydro-2H-pyrrol-5-ylamino)propane-1,3-diol?
2-(3,4-dihydro-2H-pyrrol-5-ylamino)propane-1,3-diol has a molecular weight of 158.20 g/mol, XLogP of -0.88, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-2H-pyrrol-5-ylamino)propane-1,3-diol is sourced from PubChem (CID 79503345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).