C12H16N6OS — CID 79503795
N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,3-diethylpyrazole-5-carboxamide (PubChem CID 79503795) has the molecular formula C12H16N6OS and a molecular weight of 292.37 g/mol. Its IUPAC name is N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,3-diethylpyrazole-5-carboxamide.
| Compound Name | N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,3-diethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 79503795 |
| Molecular Formula | C12H16N6OS |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | N-(4-carbamothioyl-1H-pyrazol-5-yl)-1,3-diethylpyrazole-5-carboxamide |
| SMILES | CCc1cc(C(=O)Nc2[nH]ncc2C(N)=S)n(CC)n1 |
| InChI | InChI=1S/C12H16N6OS/c1-3-7-5-9(18(4-2)17-7)12(19)15-11-8(10(13)20)6-14-16-11/h5-6H,3-4H2,1-2H3,(H2,13,20)(H2,14,15,16,19) |
| InChIKey | VZYBBLWTDUGNHC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|