C8H9F3N4OS — CID 79503980
N-(4-carbamothioyl-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide (PubChem CID 79503980) has the molecular formula C8H9F3N4OS and a molecular weight of 266.25 g/mol. Its IUPAC name is N-(4-carbamothioyl-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide.
| Compound Name | N-(4-carbamothioyl-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 79503980 |
| Molecular Formula | C8H9F3N4OS |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | N-(4-carbamothioyl-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide |
| SMILES | NC(=S)c1cn[nH]c1NC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C8H9F3N4OS/c9-8(10,11)2-1-5(16)14-7-4(6(12)17)3-13-15-7/h3H,1-2H2,(H2,12,17)(H2,13,14,15,16) |
| InChIKey | QWQPAFDXBNZYEX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|