C11H17N3O2 — CID 79504006
1-methyl-3-(2,3,4,5-tetrahydropyridin-6-ylamino)piperidine-2,6-dione (PubChem CID 79504006) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 1-methyl-3-(2,3,4,5-tetrahydropyridin-6-ylamino)piperidine-2,6-dione.
| Compound Name | 1-methyl-3-(2,3,4,5-tetrahydropyridin-6-ylamino)piperidine-2,6-dione |
|---|---|
| PubChem CID | 79504006 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 1-methyl-3-(2,3,4,5-tetrahydropyridin-6-ylamino)piperidine-2,6-dione |
| SMILES | CN1C(=O)CCC(NC2=NCCCC2)C1=O |
| InChI | InChI=1S/C11H17N3O2/c1-14-10(15)6-5-8(11(14)16)13-9-4-2-3-7-12-9/h8H,2-7H2,1H3,(H,12,13) |
| InChIKey | BEWSDYIKBOHOEL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|