About 1-cyclopropyl-2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethanol
1-cyclopropyl-2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethanol (PubChem CID 79504079) has the molecular formula C9H16N2O
and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-cyclopropyl-2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethanol.
Molecular Properties
| Compound Name | 1-cyclopropyl-2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethanol |
| PubChem CID | 79504079 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 1-cyclopropyl-2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethanol |
| SMILES | OC(CNC1=NCCC1)C1CC1 |
| InChI | InChI=1S/C9H16N2O/c12-8(7-3-4-7)6-11-9-2-1-5-10-9/h7-8,12H,1-6H2,(H,10,11) |
| InChIKey | TWXLLOJNBGGTBB-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopropyl-2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethanol?
The IUPAC name of 1-cyclopropyl-2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethanol (CID 79504079) is 1-cyclopropyl-2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethanol.
What is the SMILES notation for 1-cyclopropyl-2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethanol?
The canonical SMILES for 1-cyclopropyl-2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethanol is OC(CNC1=NCCC1)C1CC1.
What is the InChIKey of 1-cyclopropyl-2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethanol?
The InChIKey is TWXLLOJNBGGTBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O/c12-8(7-3-4-7)6-11-9-2-1-5-10-9/h7-8,12H,1-6H2,(H,10,11).
What are the key properties of 1-cyclopropyl-2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethanol?
1-cyclopropyl-2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethanol has a molecular weight of 168.24 g/mol, XLogP of 0.54, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethanol is sourced from PubChem (CID 79504079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).