C12H18N4O2S — CID 79504155
N-(4-carbamothioyl-1H-pyrazol-5-yl)-2,4,5-trimethyloxolane-3-carboxamide (PubChem CID 79504155) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is N-(4-carbamothioyl-1H-pyrazol-5-yl)-2,4,5-trimethyloxolane-3-carboxamide.
| Compound Name | N-(4-carbamothioyl-1H-pyrazol-5-yl)-2,4,5-trimethyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 79504155 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-(4-carbamothioyl-1H-pyrazol-5-yl)-2,4,5-trimethyloxolane-3-carboxamide |
| SMILES | CC1OC(C)C(C(=O)Nc2[nH]ncc2C(N)=S)C1C |
| InChI | InChI=1S/C12H18N4O2S/c1-5-6(2)18-7(3)9(5)12(17)15-11-8(10(13)19)4-14-16-11/h4-7,9H,1-3H3,(H2,13,19)(H2,14,15,16,17) |
| InChIKey | RIDLXCURLWBZFU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|