C12H20N2 — CID 79504469
N-cyclohex-3-en-1-yl-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 79504469) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N-cyclohex-3-en-1-yl-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | N-cyclohex-3-en-1-yl-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 79504469 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-cyclohex-3-en-1-yl-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | C1=CCC(NC2=NCCCCC2)CC1 |
| InChI | InChI=1S/C12H20N2/c1-3-7-11(8-4-1)14-12-9-5-2-6-10-13-12/h1,3,11H,2,4-10H2,(H,13,14) |
| InChIKey | BEWJWBRCHLYWND-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|