About N-(4-cyano-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide
N-(4-cyano-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide (PubChem CID 79504492) has the molecular formula C8H7F3N4O
and a molecular weight of 232.16 g/mol. Its IUPAC name is N-(4-cyano-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide.
Molecular Properties
| Compound Name | N-(4-cyano-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide |
| PubChem CID | 79504492 |
| Molecular Formula | C8H7F3N4O |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | N-(4-cyano-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide |
| SMILES | N#Cc1cn[nH]c1NC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C8H7F3N4O/c9-8(10,11)2-1-6(16)14-7-5(3-12)4-13-15-7/h4H,1-2H2,(H2,13,14,15,16) |
| InChIKey | GSTHUUZNNAYJCS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-cyano-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyano-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide?
The IUPAC name of N-(4-cyano-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide (CID 79504492) is N-(4-cyano-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide.
What is the SMILES notation for N-(4-cyano-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide?
The canonical SMILES for N-(4-cyano-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide is N#Cc1cn[nH]c1NC(=O)CCC(F)(F)F.
What is the InChIKey of N-(4-cyano-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide?
The InChIKey is GSTHUUZNNAYJCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3N4O/c9-8(10,11)2-1-6(16)14-7-5(3-12)4-13-15-7/h4H,1-2H2,(H2,13,14,15,16).
What are the key properties of N-(4-cyano-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide?
N-(4-cyano-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide has a molecular weight of 232.16 g/mol, XLogP of 1.56, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyano-1H-pyrazol-5-yl)-4,4,4-trifluorobutanamide is sourced from PubChem (CID 79504492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).