About N-(4-cyano-1-methylpyrazol-5-yl)-3,3,3-trifluoropropanamide
N-(4-cyano-1-methylpyrazol-5-yl)-3,3,3-trifluoropropanamide (PubChem CID 79504505) has the molecular formula C8H7F3N4O
and a molecular weight of 232.16 g/mol. Its IUPAC name is N-(4-cyano-1-methylpyrazol-5-yl)-3,3,3-trifluoropropanamide.
Molecular Properties
| Compound Name | N-(4-cyano-1-methylpyrazol-5-yl)-3,3,3-trifluoropropanamide |
| PubChem CID | 79504505 |
| Molecular Formula | C8H7F3N4O |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | N-(4-cyano-1-methylpyrazol-5-yl)-3,3,3-trifluoropropanamide |
| SMILES | Cn1ncc(C#N)c1NC(=O)CC(F)(F)F |
| InChI | InChI=1S/C8H7F3N4O/c1-15-7(5(3-12)4-13-15)14-6(16)2-8(9,10)11/h4H,2H2,1H3,(H,14,16) |
| InChIKey | VQYPKSQJNFJGRW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-cyano-1-methylpyrazol-5-yl)-3,3,3-trifluoropropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyano-1-methylpyrazol-5-yl)-3,3,3-trifluoropropanamide?
The IUPAC name of N-(4-cyano-1-methylpyrazol-5-yl)-3,3,3-trifluoropropanamide (CID 79504505) is N-(4-cyano-1-methylpyrazol-5-yl)-3,3,3-trifluoropropanamide.
What is the SMILES notation for N-(4-cyano-1-methylpyrazol-5-yl)-3,3,3-trifluoropropanamide?
The canonical SMILES for N-(4-cyano-1-methylpyrazol-5-yl)-3,3,3-trifluoropropanamide is Cn1ncc(C#N)c1NC(=O)CC(F)(F)F.
What is the InChIKey of N-(4-cyano-1-methylpyrazol-5-yl)-3,3,3-trifluoropropanamide?
The InChIKey is VQYPKSQJNFJGRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3N4O/c1-15-7(5(3-12)4-13-15)14-6(16)2-8(9,10)11/h4H,2H2,1H3,(H,14,16).
What are the key properties of N-(4-cyano-1-methylpyrazol-5-yl)-3,3,3-trifluoropropanamide?
N-(4-cyano-1-methylpyrazol-5-yl)-3,3,3-trifluoropropanamide has a molecular weight of 232.16 g/mol, XLogP of 1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyano-1-methylpyrazol-5-yl)-3,3,3-trifluoropropanamide is sourced from PubChem (CID 79504505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).