About 1-(2-chlorophenyl)-6,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine
1-(2-chlorophenyl)-6,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine (PubChem CID 79504751) has the molecular formula C16H22ClN3
and a molecular weight of 291.83 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-6,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine.
Molecular Properties
| Compound Name | 1-(2-chlorophenyl)-6,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine |
| PubChem CID | 79504751 |
| Molecular Formula | C16H22ClN3 |
| Molecular Weight | 291.83 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 1-(2-chlorophenyl)-6,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine |
| SMILES | CC1CCC2(CN=C(N)N2c2ccccc2Cl)C(C)C1 |
| InChI | InChI=1S/C16H22ClN3/c1-11-7-8-16(12(2)9-11)10-19-15(18)20(16)14-6-4-3-5-13(14)17/h3-6,11-12H,7-10H2,1-2H3,(H2,18,19) |
| InChIKey | IQIUXYJIVWPUAN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.83 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2-chlorophenyl)-6,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorophenyl)-6,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine?
The IUPAC name of 1-(2-chlorophenyl)-6,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine (CID 79504751) is 1-(2-chlorophenyl)-6,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine.
What is the SMILES notation for 1-(2-chlorophenyl)-6,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine?
The canonical SMILES for 1-(2-chlorophenyl)-6,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine is CC1CCC2(CN=C(N)N2c2ccccc2Cl)C(C)C1.
What is the InChIKey of 1-(2-chlorophenyl)-6,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine?
The InChIKey is IQIUXYJIVWPUAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22ClN3/c1-11-7-8-16(12(2)9-11)10-19-15(18)20(16)14-6-4-3-5-13(14)17/h3-6,11-12H,7-10H2,1-2H3,(H2,18,19).
What are the key properties of 1-(2-chlorophenyl)-6,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine?
1-(2-chlorophenyl)-6,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine has a molecular weight of 291.83 g/mol, XLogP of 3.67, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorophenyl)-6,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine is sourced from PubChem (CID 79504751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).