About 1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]-2'-amine
1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]-2'-amine (PubChem CID 79505227) has the molecular formula C15H21N3O
and a molecular weight of 259.35 g/mol. Its IUPAC name is 1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]-2'-amine.
Molecular Properties
| Compound Name | 1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]-2'-amine |
| PubChem CID | 79505227 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]-2'-amine |
| SMILES | COCCN1C(N)=NCC12CCc1ccccc1C2 |
| InChI | InChI=1S/C15H21N3O/c1-19-9-8-18-14(16)17-11-15(18)7-6-12-4-2-3-5-13(12)10-15/h2-5H,6-11H2,1H3,(H2,16,17) |
| InChIKey | VMQRGPXTGHHTCZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]-2'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]-2'-amine?
The IUPAC name of 1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]-2'-amine (CID 79505227) is 1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]-2'-amine.
What is the SMILES notation for 1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]-2'-amine?
The canonical SMILES for 1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]-2'-amine is COCCN1C(N)=NCC12CCc1ccccc1C2.
What is the InChIKey of 1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]-2'-amine?
The InChIKey is VMQRGPXTGHHTCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O/c1-19-9-8-18-14(16)17-11-15(18)7-6-12-4-2-3-5-13(12)10-15/h2-5H,6-11H2,1H3,(H2,16,17).
What are the key properties of 1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]-2'-amine?
1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]-2'-amine has a molecular weight of 259.35 g/mol, XLogP of 1.19, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(2-methoxyethyl)spiro[2,4-dihydro-1H-naphthalene-3,5'-4H-imidazole]-2'-amine is sourced from PubChem (CID 79505227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).