About [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-bromo-2-chlorobenzoate
[(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-bromo-2-chlorobenzoate (PubChem CID 7950575) has the molecular formula C17H14BrClO4
and a molecular weight of 397.65 g/mol. Its IUPAC name is [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-bromo-2-chlorobenzoate.
Molecular Properties
| Compound Name | [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-bromo-2-chlorobenzoate |
| PubChem CID | 7950575 |
| Molecular Formula | C17H14BrClO4 |
| Molecular Weight | 397.65 g/mol |
| Exact Mass | 395.98 |
| IUPAC Name | [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-bromo-2-chlorobenzoate |
| SMILES | COc1ccc(C(=O)[C@H](C)OC(=O)c2cc(Br)ccc2Cl)cc1 |
| InChI | InChI=1S/C17H14BrClO4/c1-10(16(20)11-3-6-13(22-2)7-4-11)23-17(21)14-9-12(18)5-8-15(14)19/h3-10H,1-2H3/t10-/m0/s1 |
| InChIKey | QPKDVFAAUPDUIV-JTQLQIEISA-N |
| XLogP | 4.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.65 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-bromo-2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-bromo-2-chlorobenzoate?
The IUPAC name of [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-bromo-2-chlorobenzoate (CID 7950575) is [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-bromo-2-chlorobenzoate.
What is the SMILES notation for [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-bromo-2-chlorobenzoate?
The canonical SMILES for [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-bromo-2-chlorobenzoate is COc1ccc(C(=O)[C@H](C)OC(=O)c2cc(Br)ccc2Cl)cc1.
What is the InChIKey of [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-bromo-2-chlorobenzoate?
The InChIKey is QPKDVFAAUPDUIV-JTQLQIEISA-N. The full InChI is InChI=1S/C17H14BrClO4/c1-10(16(20)11-3-6-13(22-2)7-4-11)23-17(21)14-9-12(18)5-8-15(14)19/h3-10H,1-2H3/t10-/m0/s1.
What are the key properties of [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-bromo-2-chlorobenzoate?
[(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-bromo-2-chlorobenzoate has a molecular weight of 397.65 g/mol, XLogP of 4.54, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 5-bromo-2-chlorobenzoate is sourced from PubChem (CID 7950575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).