About 1-(3,5-difluorophenyl)tetrazol-5-amine
1-(3,5-difluorophenyl)tetrazol-5-amine (PubChem CID 79505913) has the molecular formula C7H5F2N5
and a molecular weight of 197.15 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)tetrazol-5-amine.
Molecular Properties
| Compound Name | 1-(3,5-difluorophenyl)tetrazol-5-amine |
| PubChem CID | 79505913 |
| Molecular Formula | C7H5F2N5 |
| Molecular Weight | 197.15 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 1-(3,5-difluorophenyl)tetrazol-5-amine |
| SMILES | Nc1nnnn1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C7H5F2N5/c8-4-1-5(9)3-6(2-4)14-7(10)11-12-13-14/h1-3H,(H2,10,11,13) |
| InChIKey | UAUPCXQGQZZSBA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.15 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3,5-difluorophenyl)tetrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-difluorophenyl)tetrazol-5-amine?
The IUPAC name of 1-(3,5-difluorophenyl)tetrazol-5-amine (CID 79505913) is 1-(3,5-difluorophenyl)tetrazol-5-amine.
What is the SMILES notation for 1-(3,5-difluorophenyl)tetrazol-5-amine?
The canonical SMILES for 1-(3,5-difluorophenyl)tetrazol-5-amine is Nc1nnnn1-c1cc(F)cc(F)c1.
What is the InChIKey of 1-(3,5-difluorophenyl)tetrazol-5-amine?
The InChIKey is UAUPCXQGQZZSBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F2N5/c8-4-1-5(9)3-6(2-4)14-7(10)11-12-13-14/h1-3H,(H2,10,11,13).
What are the key properties of 1-(3,5-difluorophenyl)tetrazol-5-amine?
1-(3,5-difluorophenyl)tetrazol-5-amine has a molecular weight of 197.15 g/mol, XLogP of 0.52, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-difluorophenyl)tetrazol-5-amine is sourced from PubChem (CID 79505913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).