About (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 5-bromo-2-chlorobenzoate
(3-phenyl-1,2,4-oxadiazol-5-yl)methyl 5-bromo-2-chlorobenzoate (PubChem CID 7950615) has the molecular formula C16H10BrClN2O3
and a molecular weight of 393.62 g/mol. Its IUPAC name is (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 5-bromo-2-chlorobenzoate.
Molecular Properties
| Compound Name | (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 5-bromo-2-chlorobenzoate |
| PubChem CID | 7950615 |
| Molecular Formula | C16H10BrClN2O3 |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 5-bromo-2-chlorobenzoate |
| SMILES | O=C(OCc1nc(-c2ccccc2)no1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C16H10BrClN2O3/c17-11-6-7-13(18)12(8-11)16(21)22-9-14-19-15(20-23-14)10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | SKKGPILILPFXJR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 5-bromo-2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 5-bromo-2-chlorobenzoate?
The IUPAC name of (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 5-bromo-2-chlorobenzoate (CID 7950615) is (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 5-bromo-2-chlorobenzoate.
What is the SMILES notation for (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 5-bromo-2-chlorobenzoate?
The canonical SMILES for (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 5-bromo-2-chlorobenzoate is O=C(OCc1nc(-c2ccccc2)no1)c1cc(Br)ccc1Cl.
What is the InChIKey of (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 5-bromo-2-chlorobenzoate?
The InChIKey is SKKGPILILPFXJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10BrClN2O3/c17-11-6-7-13(18)12(8-11)16(21)22-9-14-19-15(20-23-14)10-4-2-1-3-5-10/h1-8H,9H2.
What are the key properties of (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 5-bromo-2-chlorobenzoate?
(3-phenyl-1,2,4-oxadiazol-5-yl)methyl 5-bromo-2-chlorobenzoate has a molecular weight of 393.62 g/mol, XLogP of 4.51, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 5-bromo-2-chlorobenzoate is sourced from PubChem (CID 7950615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).