C11H13N5 — CID 79506698
1-(5,6,7,8-tetrahydronaphthalen-1-yl)tetrazol-5-amine (PubChem CID 79506698) has the molecular formula C11H13N5 and a molecular weight of 215.26 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydronaphthalen-1-yl)tetrazol-5-amine.
| Compound Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)tetrazol-5-amine |
|---|---|
| PubChem CID | 79506698 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 1-(5,6,7,8-tetrahydronaphthalen-1-yl)tetrazol-5-amine |
| SMILES | Nc1nnnn1-c1cccc2c1CCCC2 |
| InChI | InChI=1S/C11H13N5/c12-11-13-14-15-16(11)10-7-3-5-8-4-1-2-6-9(8)10/h3,5,7H,1-2,4,6H2,(H2,12,13,15) |
| InChIKey | YBFMDYJGEMPQDK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |