C14H14FNO3 — CID 79506746
1-[2-(2-fluorophenyl)-2-oxoethyl]-4-methylpiperidine-2,6-dione (PubChem CID 79506746) has the molecular formula C14H14FNO3 and a molecular weight of 263.27 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)-2-oxoethyl]-4-methylpiperidine-2,6-dione.
| Compound Name | 1-[2-(2-fluorophenyl)-2-oxoethyl]-4-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 79506746 |
| Molecular Formula | C14H14FNO3 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 1-[2-(2-fluorophenyl)-2-oxoethyl]-4-methylpiperidine-2,6-dione |
| SMILES | CC1CC(=O)N(CC(=O)c2ccccc2F)C(=O)C1 |
| InChI | InChI=1S/C14H14FNO3/c1-9-6-13(18)16(14(19)7-9)8-12(17)10-4-2-3-5-11(10)15/h2-5,9H,6-8H2,1H3 |
| InChIKey | DYIAWVYJQWHXDO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|