C11H15IN2OS — CID 79506771
(3,3-dimethylpiperazin-1-yl)-(5-iodothiophen-3-yl)methanone (PubChem CID 79506771) has the molecular formula C11H15IN2OS and a molecular weight of 350.23 g/mol. Its IUPAC name is (3,3-dimethylpiperazin-1-yl)-(5-iodothiophen-3-yl)methanone.
| Compound Name | (3,3-dimethylpiperazin-1-yl)-(5-iodothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 79506771 |
| Molecular Formula | C11H15IN2OS |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | (3,3-dimethylpiperazin-1-yl)-(5-iodothiophen-3-yl)methanone |
| SMILES | CC1(C)CN(C(=O)c2csc(I)c2)CCN1 |
| InChI | InChI=1S/C11H15IN2OS/c1-11(2)7-14(4-3-13-11)10(15)8-5-9(12)16-6-8/h5-6,13H,3-4,7H2,1-2H3 |
| InChIKey | HHDHFLJJDFESFG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|