About 1-benzyl-8,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine
1-benzyl-8,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine (PubChem CID 79507017) has the molecular formula C17H25N3
and a molecular weight of 271.41 g/mol. Its IUPAC name is 1-benzyl-8,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine.
Molecular Properties
| Compound Name | 1-benzyl-8,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine |
| PubChem CID | 79507017 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 1-benzyl-8,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine |
| SMILES | CC1(C)CCC2(CC1)CN=C(N)N2Cc1ccccc1 |
| InChI | InChI=1S/C17H25N3/c1-16(2)8-10-17(11-9-16)13-19-15(18)20(17)12-14-6-4-3-5-7-14/h3-7H,8-13H2,1-2H3,(H2,18,19) |
| InChIKey | LBYWMFFRCTUAQR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzyl-8,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-8,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine?
The IUPAC name of 1-benzyl-8,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine (CID 79507017) is 1-benzyl-8,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine.
What is the SMILES notation for 1-benzyl-8,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine?
The canonical SMILES for 1-benzyl-8,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine is CC1(C)CCC2(CC1)CN=C(N)N2Cc1ccccc1.
What is the InChIKey of 1-benzyl-8,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine?
The InChIKey is LBYWMFFRCTUAQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25N3/c1-16(2)8-10-17(11-9-16)13-19-15(18)20(17)12-14-6-4-3-5-7-14/h3-7H,8-13H2,1-2H3,(H2,18,19).
What are the key properties of 1-benzyl-8,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine?
1-benzyl-8,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine has a molecular weight of 271.41 g/mol, XLogP of 3.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-8,8-dimethyl-1,3-diazaspiro[4.5]dec-2-en-2-amine is sourced from PubChem (CID 79507017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).