About 7-(trifluoromethyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine
7-(trifluoromethyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine (PubChem CID 79507320) has the molecular formula C9H14F3N3
and a molecular weight of 221.23 g/mol. Its IUPAC name is 7-(trifluoromethyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine.
Molecular Properties
| Compound Name | 7-(trifluoromethyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine |
| PubChem CID | 79507320 |
| Molecular Formula | C9H14F3N3 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 7-(trifluoromethyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine |
| SMILES | NC1=NCC2(CCCC(C(F)(F)F)C2)N1 |
| InChI | InChI=1S/C9H14F3N3/c10-9(11,12)6-2-1-3-8(4-6)5-14-7(13)15-8/h6H,1-5H2,(H3,13,14,15) |
| InChIKey | YJSLCLHJRDUFMO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-(trifluoromethyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(trifluoromethyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine?
The IUPAC name of 7-(trifluoromethyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine (CID 79507320) is 7-(trifluoromethyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine.
What is the SMILES notation for 7-(trifluoromethyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine?
The canonical SMILES for 7-(trifluoromethyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine is NC1=NCC2(CCCC(C(F)(F)F)C2)N1.
What is the InChIKey of 7-(trifluoromethyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine?
The InChIKey is YJSLCLHJRDUFMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3N3/c10-9(11,12)6-2-1-3-8(4-6)5-14-7(13)15-8/h6H,1-5H2,(H3,13,14,15).
What are the key properties of 7-(trifluoromethyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine?
7-(trifluoromethyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine has a molecular weight of 221.23 g/mol, XLogP of 1.40, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(trifluoromethyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine is sourced from PubChem (CID 79507320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).