C12H15BrN2 — CID 79508130
N-[1-(3-bromophenyl)ethyl]-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 79508130) has the molecular formula C12H15BrN2 and a molecular weight of 267.17 g/mol. Its IUPAC name is N-[1-(3-bromophenyl)ethyl]-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | N-[1-(3-bromophenyl)ethyl]-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 79508130 |
| Molecular Formula | C12H15BrN2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | N-[1-(3-bromophenyl)ethyl]-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | CC(NC1=NCCC1)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H15BrN2/c1-9(15-12-6-3-7-14-12)10-4-2-5-11(13)8-10/h2,4-5,8-9H,3,6-7H2,1H3,(H,14,15) |
| InChIKey | BVJWGCFHCYOUIG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |