About 1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-5-cyclopropyltriazol-4-amine
1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-5-cyclopropyltriazol-4-amine (PubChem CID 79508205) has the molecular formula C11H9ClN6S
and a molecular weight of 292.75 g/mol. Its IUPAC name is 1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-5-cyclopropyltriazol-4-amine.
Molecular Properties
| Compound Name | 1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-5-cyclopropyltriazol-4-amine |
| PubChem CID | 79508205 |
| Molecular Formula | C11H9ClN6S |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-5-cyclopropyltriazol-4-amine |
| SMILES | Nc1nnn(-c2c(Cl)ccc3nsnc23)c1C1CC1 |
| InChI | InChI=1S/C11H9ClN6S/c12-6-3-4-7-8(16-19-15-7)10(6)18-9(5-1-2-5)11(13)14-17-18/h3-5H,1-2,13H2 |
| InChIKey | GSDCRYLRGWRAMY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-5-cyclopropyltriazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-5-cyclopropyltriazol-4-amine?
The IUPAC name of 1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-5-cyclopropyltriazol-4-amine (CID 79508205) is 1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-5-cyclopropyltriazol-4-amine.
What is the SMILES notation for 1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-5-cyclopropyltriazol-4-amine?
The canonical SMILES for 1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-5-cyclopropyltriazol-4-amine is Nc1nnn(-c2c(Cl)ccc3nsnc23)c1C1CC1.
What is the InChIKey of 1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-5-cyclopropyltriazol-4-amine?
The InChIKey is GSDCRYLRGWRAMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN6S/c12-6-3-4-7-8(16-19-15-7)10(6)18-9(5-1-2-5)11(13)14-17-18/h3-5H,1-2,13H2.
What are the key properties of 1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-5-cyclopropyltriazol-4-amine?
1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-5-cyclopropyltriazol-4-amine has a molecular weight of 292.75 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-2,1,3-benzothiadiazol-4-yl)-5-cyclopropyltriazol-4-amine is sourced from PubChem (CID 79508205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).