About 2-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)propan-1-ol
2-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)propan-1-ol (PubChem CID 79508228) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is 2-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)propan-1-ol.
Analyze 2-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)propan-1-ol?
The IUPAC name of 2-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)propan-1-ol (CID 79508228) is 2-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)propan-1-ol.
What is the SMILES notation for 2-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)propan-1-ol?
The canonical SMILES for 2-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)propan-1-ol is CC(CO)NC1=NCCCCC1.
What is the InChIKey of 2-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)propan-1-ol?
The InChIKey is ZLSHJJSLXPPXHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O/c1-8(7-12)11-9-5-3-2-4-6-10-9/h8,12H,2-7H2,1H3,(H,10,11).
What are the key properties of 2-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)propan-1-ol?
2-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)propan-1-ol has a molecular weight of 170.26 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4,5,6-tetrahydro-2H-azepin-7-ylamino)propan-1-ol is sourced from PubChem (CID 79508228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).