C13H26N2O — CID 79508900
N-[2-(3-methylbutoxy)ethyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 79508900) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is N-[2-(3-methylbutoxy)ethyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | N-[2-(3-methylbutoxy)ethyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 79508900 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | N-[2-(3-methylbutoxy)ethyl]-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | CC(C)CCOCCNC1=NCCCCC1 |
| InChI | InChI=1S/C13H26N2O/c1-12(2)7-10-16-11-9-15-13-6-4-3-5-8-14-13/h12H,3-11H2,1-2H3,(H,14,15) |
| InChIKey | UEPFDOXQSJNAPH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|