About 2-[4-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)triazol-1-yl]ethanol
2-[4-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)triazol-1-yl]ethanol (PubChem CID 79509398) has the molecular formula C9H16N6O
and a molecular weight of 224.27 g/mol. Its IUPAC name is 2-[4-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)triazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)triazol-1-yl]ethanol |
| PubChem CID | 79509398 |
| Molecular Formula | C9H16N6O |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 2-[4-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)triazol-1-yl]ethanol |
| SMILES | CCN1C(N)=NCC1c1cn(CCO)nn1 |
| InChI | InChI=1S/C9H16N6O/c1-2-15-8(5-11-9(15)10)7-6-14(3-4-16)13-12-7/h6,8,16H,2-5H2,1H3,(H2,10,11) |
| InChIKey | ORAIGYMUAGNCGB-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)triazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)triazol-1-yl]ethanol?
The IUPAC name of 2-[4-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)triazol-1-yl]ethanol (CID 79509398) is 2-[4-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)triazol-1-yl]ethanol.
What is the SMILES notation for 2-[4-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)triazol-1-yl]ethanol?
The canonical SMILES for 2-[4-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)triazol-1-yl]ethanol is CCN1C(N)=NCC1c1cn(CCO)nn1.
What is the InChIKey of 2-[4-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)triazol-1-yl]ethanol?
The InChIKey is ORAIGYMUAGNCGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N6O/c1-2-15-8(5-11-9(15)10)7-6-14(3-4-16)13-12-7/h6,8,16H,2-5H2,1H3,(H2,10,11).
What are the key properties of 2-[4-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)triazol-1-yl]ethanol?
2-[4-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)triazol-1-yl]ethanol has a molecular weight of 224.27 g/mol, XLogP of -1.04, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)triazol-1-yl]ethanol is sourced from PubChem (CID 79509398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).