About 5-pentan-2-yl-1-propyl-4,5-dihydroimidazol-2-amine
5-pentan-2-yl-1-propyl-4,5-dihydroimidazol-2-amine (PubChem CID 79509853) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is 5-pentan-2-yl-1-propyl-4,5-dihydroimidazol-2-amine.
Molecular Properties
| Compound Name | 5-pentan-2-yl-1-propyl-4,5-dihydroimidazol-2-amine |
| PubChem CID | 79509853 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 5-pentan-2-yl-1-propyl-4,5-dihydroimidazol-2-amine |
| SMILES | CCCC(C)C1CN=C(N)N1CCC |
| InChI | InChI=1S/C11H23N3/c1-4-6-9(3)10-8-13-11(12)14(10)7-5-2/h9-10H,4-8H2,1-3H3,(H2,12,13) |
| InChIKey | RTLWSOWBAALPSJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-pentan-2-yl-1-propyl-4,5-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pentan-2-yl-1-propyl-4,5-dihydroimidazol-2-amine?
The IUPAC name of 5-pentan-2-yl-1-propyl-4,5-dihydroimidazol-2-amine (CID 79509853) is 5-pentan-2-yl-1-propyl-4,5-dihydroimidazol-2-amine.
What is the SMILES notation for 5-pentan-2-yl-1-propyl-4,5-dihydroimidazol-2-amine?
The canonical SMILES for 5-pentan-2-yl-1-propyl-4,5-dihydroimidazol-2-amine is CCCC(C)C1CN=C(N)N1CCC.
What is the InChIKey of 5-pentan-2-yl-1-propyl-4,5-dihydroimidazol-2-amine?
The InChIKey is RTLWSOWBAALPSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3/c1-4-6-9(3)10-8-13-11(12)14(10)7-5-2/h9-10H,4-8H2,1-3H3,(H2,12,13).
What are the key properties of 5-pentan-2-yl-1-propyl-4,5-dihydroimidazol-2-amine?
5-pentan-2-yl-1-propyl-4,5-dihydroimidazol-2-amine has a molecular weight of 197.33 g/mol, XLogP of 1.83, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pentan-2-yl-1-propyl-4,5-dihydroimidazol-2-amine is sourced from PubChem (CID 79509853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).