About 4-(2-amino-1,5-diethyl-4H-imidazol-5-yl)phenol
4-(2-amino-1,5-diethyl-4H-imidazol-5-yl)phenol (PubChem CID 79510374) has the molecular formula C13H19N3O
and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-(2-amino-1,5-diethyl-4H-imidazol-5-yl)phenol.
Molecular Properties
| Compound Name | 4-(2-amino-1,5-diethyl-4H-imidazol-5-yl)phenol |
| PubChem CID | 79510374 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 4-(2-amino-1,5-diethyl-4H-imidazol-5-yl)phenol |
| SMILES | CCN1C(N)=NCC1(CC)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H19N3O/c1-3-13(9-15-12(14)16(13)4-2)10-5-7-11(17)8-6-10/h5-8,17H,3-4,9H2,1-2H3,(H2,14,15) |
| InChIKey | AFFHVZFTWUNHHX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-amino-1,5-diethyl-4H-imidazol-5-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-1,5-diethyl-4H-imidazol-5-yl)phenol?
The IUPAC name of 4-(2-amino-1,5-diethyl-4H-imidazol-5-yl)phenol (CID 79510374) is 4-(2-amino-1,5-diethyl-4H-imidazol-5-yl)phenol.
What is the SMILES notation for 4-(2-amino-1,5-diethyl-4H-imidazol-5-yl)phenol?
The canonical SMILES for 4-(2-amino-1,5-diethyl-4H-imidazol-5-yl)phenol is CCN1C(N)=NCC1(CC)c1ccc(O)cc1.
What is the InChIKey of 4-(2-amino-1,5-diethyl-4H-imidazol-5-yl)phenol?
The InChIKey is AFFHVZFTWUNHHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O/c1-3-13(9-15-12(14)16(13)4-2)10-5-7-11(17)8-6-10/h5-8,17H,3-4,9H2,1-2H3,(H2,14,15).
What are the key properties of 4-(2-amino-1,5-diethyl-4H-imidazol-5-yl)phenol?
4-(2-amino-1,5-diethyl-4H-imidazol-5-yl)phenol has a molecular weight of 233.31 g/mol, XLogP of 1.65, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-1,5-diethyl-4H-imidazol-5-yl)phenol is sourced from PubChem (CID 79510374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).