C11H15N3O — CID 79510385
3-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)phenol (PubChem CID 79510385) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)phenol.
| Compound Name | 3-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)phenol |
|---|---|
| PubChem CID | 79510385 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 3-(2-amino-3-ethyl-4,5-dihydroimidazol-4-yl)phenol |
| SMILES | CCN1C(N)=NCC1c1cccc(O)c1 |
| InChI | InChI=1S/C11H15N3O/c1-2-14-10(7-13-11(14)12)8-4-3-5-9(15)6-8/h3-6,10,15H,2,7H2,1H3,(H2,12,13) |
| InChIKey | KIHWFHWXPKCVPO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |