About 5-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine
5-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 79510801) has the molecular formula C11H15N3O
and a molecular weight of 205.26 g/mol. Its IUPAC name is 5-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine.
Molecular Properties
| Compound Name | 5-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine |
| PubChem CID | 79510801 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 5-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CCOc1ccccc1C1CN=C(N)N1 |
| InChI | InChI=1S/C11H15N3O/c1-2-15-10-6-4-3-5-8(10)9-7-13-11(12)14-9/h3-6,9H,2,7H2,1H3,(H3,12,13,14) |
| InChIKey | HVCYGFNCRVLPJP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine?
The IUPAC name of 5-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine (CID 79510801) is 5-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine.
What is the SMILES notation for 5-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine?
The canonical SMILES for 5-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine is CCOc1ccccc1C1CN=C(N)N1.
What is the InChIKey of 5-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine?
The InChIKey is HVCYGFNCRVLPJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O/c1-2-15-10-6-4-3-5-8(10)9-7-13-11(12)14-9/h3-6,9H,2,7H2,1H3,(H3,12,13,14).
What are the key properties of 5-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine?
5-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine has a molecular weight of 205.26 g/mol, XLogP of 1.04, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-ethoxyphenyl)-4,5-dihydro-1H-imidazol-2-amine is sourced from PubChem (CID 79510801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).