C11H11F4NO2 — CID 79512136
2-fluoro-6-[methyl(3,3,3-trifluoropropyl)amino]benzoic acid (PubChem CID 79512136) has the molecular formula C11H11F4NO2 and a molecular weight of 265.21 g/mol. Its IUPAC name is 2-fluoro-6-[methyl(3,3,3-trifluoropropyl)amino]benzoic acid.
| Compound Name | 2-fluoro-6-[methyl(3,3,3-trifluoropropyl)amino]benzoic acid |
|---|---|
| PubChem CID | 79512136 |
| Molecular Formula | C11H11F4NO2 |
| Molecular Weight | 265.21 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-fluoro-6-[methyl(3,3,3-trifluoropropyl)amino]benzoic acid |
| SMILES | CN(CCC(F)(F)F)c1cccc(F)c1C(=O)O |
| InChI | InChI=1S/C11H11F4NO2/c1-16(6-5-11(13,14)15)8-4-2-3-7(12)9(8)10(17)18/h2-4H,5-6H2,1H3,(H,17,18) |
| InChIKey | WCWWXYSTYNKZBG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.21 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |