About 2-(3,5-dioxopiperazin-1-yl)-6-fluorobenzonitrile
2-(3,5-dioxopiperazin-1-yl)-6-fluorobenzonitrile (PubChem CID 79512638) has the molecular formula C11H8FN3O2
and a molecular weight of 233.20 g/mol. Its IUPAC name is 2-(3,5-dioxopiperazin-1-yl)-6-fluorobenzonitrile.
Molecular Properties
| Compound Name | 2-(3,5-dioxopiperazin-1-yl)-6-fluorobenzonitrile |
| PubChem CID | 79512638 |
| Molecular Formula | C11H8FN3O2 |
| Molecular Weight | 233.20 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 2-(3,5-dioxopiperazin-1-yl)-6-fluorobenzonitrile |
| SMILES | N#Cc1c(F)cccc1N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C11H8FN3O2/c12-8-2-1-3-9(7(8)4-13)15-5-10(16)14-11(17)6-15/h1-3H,5-6H2,(H,14,16,17) |
| InChIKey | PYRILXYGBZYBRW-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dioxopiperazin-1-yl)-6-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dioxopiperazin-1-yl)-6-fluorobenzonitrile?
The IUPAC name of 2-(3,5-dioxopiperazin-1-yl)-6-fluorobenzonitrile (CID 79512638) is 2-(3,5-dioxopiperazin-1-yl)-6-fluorobenzonitrile.
What is the SMILES notation for 2-(3,5-dioxopiperazin-1-yl)-6-fluorobenzonitrile?
The canonical SMILES for 2-(3,5-dioxopiperazin-1-yl)-6-fluorobenzonitrile is N#Cc1c(F)cccc1N1CC(=O)NC(=O)C1.
What is the InChIKey of 2-(3,5-dioxopiperazin-1-yl)-6-fluorobenzonitrile?
The InChIKey is PYRILXYGBZYBRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FN3O2/c12-8-2-1-3-9(7(8)4-13)15-5-10(16)14-11(17)6-15/h1-3H,5-6H2,(H,14,16,17).
What are the key properties of 2-(3,5-dioxopiperazin-1-yl)-6-fluorobenzonitrile?
2-(3,5-dioxopiperazin-1-yl)-6-fluorobenzonitrile has a molecular weight of 233.20 g/mol, XLogP of 0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dioxopiperazin-1-yl)-6-fluorobenzonitrile is sourced from PubChem (CID 79512638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).