C13H19FN2OS — CID 79512885
2-fluoro-6-[3-hydroxypropyl(propan-2-yl)amino]benzenecarbothioamide (PubChem CID 79512885) has the molecular formula C13H19FN2OS and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-fluoro-6-[3-hydroxypropyl(propan-2-yl)amino]benzenecarbothioamide.
| Compound Name | 2-fluoro-6-[3-hydroxypropyl(propan-2-yl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 79512885 |
| Molecular Formula | C13H19FN2OS |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-fluoro-6-[3-hydroxypropyl(propan-2-yl)amino]benzenecarbothioamide |
| SMILES | CC(C)N(CCCO)c1cccc(F)c1C(N)=S |
| InChI | InChI=1S/C13H19FN2OS/c1-9(2)16(7-4-8-17)11-6-3-5-10(14)12(11)13(15)18/h3,5-6,9,17H,4,7-8H2,1-2H3,(H2,15,18) |
| InChIKey | DTMAVMXJJONIEG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|