About 2-fluoro-6-(N,3,5-trimethylanilino)benzonitrile
2-fluoro-6-(N,3,5-trimethylanilino)benzonitrile (PubChem CID 79513658) has the molecular formula C16H15FN2
and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-fluoro-6-(N,3,5-trimethylanilino)benzonitrile.
Molecular Properties
| Compound Name | 2-fluoro-6-(N,3,5-trimethylanilino)benzonitrile |
| PubChem CID | 79513658 |
| Molecular Formula | C16H15FN2 |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-fluoro-6-(N,3,5-trimethylanilino)benzonitrile |
| SMILES | Cc1cc(C)cc(N(C)c2cccc(F)c2C#N)c1 |
| InChI | InChI=1S/C16H15FN2/c1-11-7-12(2)9-13(8-11)19(3)16-6-4-5-15(17)14(16)10-18/h4-9H,1-3H3 |
| InChIKey | RFPYVJORRWHUBG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-fluoro-6-(N,3,5-trimethylanilino)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-6-(N,3,5-trimethylanilino)benzonitrile?
The IUPAC name of 2-fluoro-6-(N,3,5-trimethylanilino)benzonitrile (CID 79513658) is 2-fluoro-6-(N,3,5-trimethylanilino)benzonitrile.
What is the SMILES notation for 2-fluoro-6-(N,3,5-trimethylanilino)benzonitrile?
The canonical SMILES for 2-fluoro-6-(N,3,5-trimethylanilino)benzonitrile is Cc1cc(C)cc(N(C)c2cccc(F)c2C#N)c1.
What is the InChIKey of 2-fluoro-6-(N,3,5-trimethylanilino)benzonitrile?
The InChIKey is RFPYVJORRWHUBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FN2/c1-11-7-12(2)9-13(8-11)19(3)16-6-4-5-15(17)14(16)10-18/h4-9H,1-3H3.
What are the key properties of 2-fluoro-6-(N,3,5-trimethylanilino)benzonitrile?
2-fluoro-6-(N,3,5-trimethylanilino)benzonitrile has a molecular weight of 254.31 g/mol, XLogP of 4.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-6-(N,3,5-trimethylanilino)benzonitrile is sourced from PubChem (CID 79513658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).