C18H17F2NO3 — CID 7951419
[(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl] 2,4-difluorobenzoate (PubChem CID 7951419) has the molecular formula C18H17F2NO3 and a molecular weight of 333.33 g/mol. Its IUPAC name is [(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl] 2,4-difluorobenzoate.
| Compound Name | [(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl] 2,4-difluorobenzoate |
|---|---|
| PubChem CID | 7951419 |
| Molecular Formula | C18H17F2NO3 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | [(2R)-1-(4-ethylanilino)-1-oxopropan-2-yl] 2,4-difluorobenzoate |
| SMILES | CCc1ccc(NC(=O)[C@@H](C)OC(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H17F2NO3/c1-3-12-4-7-14(8-5-12)21-17(22)11(2)24-18(23)15-9-6-13(19)10-16(15)20/h4-11H,3H2,1-2H3,(H,21,22)/t11-/m1/s1 |
| InChIKey | STUXOHLFTPKBHD-LLVKDONJSA-N |
| XLogP | 3.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |