About 1-butan-2-yl-5-(2,3-dimethylphenyl)-4,5-dihydroimidazol-2-amine
1-butan-2-yl-5-(2,3-dimethylphenyl)-4,5-dihydroimidazol-2-amine (PubChem CID 79514209) has the molecular formula C15H23N3
and a molecular weight of 245.37 g/mol. Its IUPAC name is 1-butan-2-yl-5-(2,3-dimethylphenyl)-4,5-dihydroimidazol-2-amine.
Molecular Properties
| Compound Name | 1-butan-2-yl-5-(2,3-dimethylphenyl)-4,5-dihydroimidazol-2-amine |
| PubChem CID | 79514209 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 1-butan-2-yl-5-(2,3-dimethylphenyl)-4,5-dihydroimidazol-2-amine |
| SMILES | CCC(C)N1C(N)=NCC1c1cccc(C)c1C |
| InChI | InChI=1S/C15H23N3/c1-5-11(3)18-14(9-17-15(18)16)13-8-6-7-10(2)12(13)4/h6-8,11,14H,5,9H2,1-4H3,(H2,16,17) |
| InChIKey | YOEOTAUKHWVWAI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butan-2-yl-5-(2,3-dimethylphenyl)-4,5-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-5-(2,3-dimethylphenyl)-4,5-dihydroimidazol-2-amine?
The IUPAC name of 1-butan-2-yl-5-(2,3-dimethylphenyl)-4,5-dihydroimidazol-2-amine (CID 79514209) is 1-butan-2-yl-5-(2,3-dimethylphenyl)-4,5-dihydroimidazol-2-amine.
What is the SMILES notation for 1-butan-2-yl-5-(2,3-dimethylphenyl)-4,5-dihydroimidazol-2-amine?
The canonical SMILES for 1-butan-2-yl-5-(2,3-dimethylphenyl)-4,5-dihydroimidazol-2-amine is CCC(C)N1C(N)=NCC1c1cccc(C)c1C.
What is the InChIKey of 1-butan-2-yl-5-(2,3-dimethylphenyl)-4,5-dihydroimidazol-2-amine?
The InChIKey is YOEOTAUKHWVWAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3/c1-5-11(3)18-14(9-17-15(18)16)13-8-6-7-10(2)12(13)4/h6-8,11,14H,5,9H2,1-4H3,(H2,16,17).
What are the key properties of 1-butan-2-yl-5-(2,3-dimethylphenyl)-4,5-dihydroimidazol-2-amine?
1-butan-2-yl-5-(2,3-dimethylphenyl)-4,5-dihydroimidazol-2-amine has a molecular weight of 245.37 g/mol, XLogP of 2.77, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-5-(2,3-dimethylphenyl)-4,5-dihydroimidazol-2-amine is sourced from PubChem (CID 79514209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).