About 1-phenyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine
1-phenyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine (PubChem CID 79514380) has the molecular formula C16H24N4
and a molecular weight of 272.40 g/mol. Its IUPAC name is 1-phenyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine.
Molecular Properties
| Compound Name | 1-phenyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine |
| PubChem CID | 79514380 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 1-phenyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine |
| SMILES | CCCN1CCC2(CC1)CN=C(N)N2c1ccccc1 |
| InChI | InChI=1S/C16H24N4/c1-2-10-19-11-8-16(9-12-19)13-18-15(17)20(16)14-6-4-3-5-7-14/h3-7H,2,8-13H2,1H3,(H2,17,18) |
| InChIKey | XXVNSLCMNUVYRC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-phenyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine?
The IUPAC name of 1-phenyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine (CID 79514380) is 1-phenyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine.
What is the SMILES notation for 1-phenyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine?
The canonical SMILES for 1-phenyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine is CCCN1CCC2(CC1)CN=C(N)N2c1ccccc1.
What is the InChIKey of 1-phenyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine?
The InChIKey is XXVNSLCMNUVYRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4/c1-2-10-19-11-8-16(9-12-19)13-18-15(17)20(16)14-6-4-3-5-7-14/h3-7H,2,8-13H2,1H3,(H2,17,18).
What are the key properties of 1-phenyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine?
1-phenyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine has a molecular weight of 272.40 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-8-propyl-1,3,8-triazaspiro[4.5]dec-2-en-2-amine is sourced from PubChem (CID 79514380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).