C15H23N3O — CID 79514418
1-(3-methoxyphenyl)-5-pentan-2-yl-4,5-dihydroimidazol-2-amine (PubChem CID 79514418) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-5-pentan-2-yl-4,5-dihydroimidazol-2-amine.
| Compound Name | 1-(3-methoxyphenyl)-5-pentan-2-yl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 79514418 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 1-(3-methoxyphenyl)-5-pentan-2-yl-4,5-dihydroimidazol-2-amine |
| SMILES | CCCC(C)C1CN=C(N)N1c1cccc(OC)c1 |
| InChI | InChI=1S/C15H23N3O/c1-4-6-11(2)14-10-17-15(16)18(14)12-7-5-8-13(9-12)19-3/h5,7-9,11,14H,4,6,10H2,1-3H3,(H2,16,17) |
| InChIKey | TYOOIVDYKKGHPW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |