About 2'-amino-1'-butan-2-ylspiro[2H-1-benzofuran-3,5'-4H-imidazole]-6-ol
2'-amino-1'-butan-2-ylspiro[2H-1-benzofuran-3,5'-4H-imidazole]-6-ol (PubChem CID 79515037) has the molecular formula C14H19N3O2
and a molecular weight of 261.32 g/mol. Its IUPAC name is 2'-amino-1'-butan-2-ylspiro[2H-1-benzofuran-3,5'-4H-imidazole]-6-ol.
Molecular Properties
| Compound Name | 2'-amino-1'-butan-2-ylspiro[2H-1-benzofuran-3,5'-4H-imidazole]-6-ol |
| PubChem CID | 79515037 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2'-amino-1'-butan-2-ylspiro[2H-1-benzofuran-3,5'-4H-imidazole]-6-ol |
| SMILES | CCC(C)N1C(N)=NCC12COc1cc(O)ccc12 |
| InChI | InChI=1S/C14H19N3O2/c1-3-9(2)17-13(15)16-7-14(17)8-19-12-6-10(18)4-5-11(12)14/h4-6,9,18H,3,7-8H2,1-2H3,(H2,15,16) |
| InChIKey | VTWDBIDDRUNARJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2'-amino-1'-butan-2-ylspiro[2H-1-benzofuran-3,5'-4H-imidazole]-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-amino-1'-butan-2-ylspiro[2H-1-benzofuran-3,5'-4H-imidazole]-6-ol?
The IUPAC name of 2'-amino-1'-butan-2-ylspiro[2H-1-benzofuran-3,5'-4H-imidazole]-6-ol (CID 79515037) is 2'-amino-1'-butan-2-ylspiro[2H-1-benzofuran-3,5'-4H-imidazole]-6-ol.
What is the SMILES notation for 2'-amino-1'-butan-2-ylspiro[2H-1-benzofuran-3,5'-4H-imidazole]-6-ol?
The canonical SMILES for 2'-amino-1'-butan-2-ylspiro[2H-1-benzofuran-3,5'-4H-imidazole]-6-ol is CCC(C)N1C(N)=NCC12COc1cc(O)ccc12.
What is the InChIKey of 2'-amino-1'-butan-2-ylspiro[2H-1-benzofuran-3,5'-4H-imidazole]-6-ol?
The InChIKey is VTWDBIDDRUNARJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O2/c1-3-9(2)17-13(15)16-7-14(17)8-19-12-6-10(18)4-5-11(12)14/h4-6,9,18H,3,7-8H2,1-2H3,(H2,15,16).
What are the key properties of 2'-amino-1'-butan-2-ylspiro[2H-1-benzofuran-3,5'-4H-imidazole]-6-ol?
2'-amino-1'-butan-2-ylspiro[2H-1-benzofuran-3,5'-4H-imidazole]-6-ol has a molecular weight of 261.32 g/mol, XLogP of 1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-amino-1'-butan-2-ylspiro[2H-1-benzofuran-3,5'-4H-imidazole]-6-ol is sourced from PubChem (CID 79515037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).