About 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-4-methoxyaniline
2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-4-methoxyaniline (PubChem CID 79515206) has the molecular formula C14H13N3O3S
and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-4-methoxyaniline.
Molecular Properties
| Compound Name | 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-4-methoxyaniline |
| PubChem CID | 79515206 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-4-methoxyaniline |
| SMILES | COc1ccc(N)c(SCc2noc(-c3ccco3)n2)c1 |
| InChI | InChI=1S/C14H13N3O3S/c1-18-9-4-5-10(15)12(7-9)21-8-13-16-14(20-17-13)11-3-2-6-19-11/h2-7H,8,15H2,1H3 |
| InChIKey | UHDQDABYQOWASW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-4-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-4-methoxyaniline?
The IUPAC name of 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-4-methoxyaniline (CID 79515206) is 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-4-methoxyaniline.
What is the SMILES notation for 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-4-methoxyaniline?
The canonical SMILES for 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-4-methoxyaniline is COc1ccc(N)c(SCc2noc(-c3ccco3)n2)c1.
What is the InChIKey of 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-4-methoxyaniline?
The InChIKey is UHDQDABYQOWASW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O3S/c1-18-9-4-5-10(15)12(7-9)21-8-13-16-14(20-17-13)11-3-2-6-19-11/h2-7H,8,15H2,1H3.
What are the key properties of 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-4-methoxyaniline?
2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-4-methoxyaniline has a molecular weight of 303.34 g/mol, XLogP of 3.21, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(furan-2-yl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-4-methoxyaniline is sourced from PubChem (CID 79515206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).