About 1-(3-methyl-1,1-dioxothiolan-3-yl)piperidine-2,4-dione
1-(3-methyl-1,1-dioxothiolan-3-yl)piperidine-2,4-dione (PubChem CID 79515274) has the molecular formula C10H15NO4S
and a molecular weight of 245.30 g/mol. Its IUPAC name is 1-(3-methyl-1,1-dioxothiolan-3-yl)piperidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(3-methyl-1,1-dioxothiolan-3-yl)piperidine-2,4-dione |
| PubChem CID | 79515274 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1-(3-methyl-1,1-dioxothiolan-3-yl)piperidine-2,4-dione |
| SMILES | CC1(N2CCC(=O)CC2=O)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H15NO4S/c1-10(3-5-16(14,15)7-10)11-4-2-8(12)6-9(11)13/h2-7H2,1H3 |
| InChIKey | XJVODDSUQHVILW-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methyl-1,1-dioxothiolan-3-yl)piperidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methyl-1,1-dioxothiolan-3-yl)piperidine-2,4-dione?
The IUPAC name of 1-(3-methyl-1,1-dioxothiolan-3-yl)piperidine-2,4-dione (CID 79515274) is 1-(3-methyl-1,1-dioxothiolan-3-yl)piperidine-2,4-dione.
What is the SMILES notation for 1-(3-methyl-1,1-dioxothiolan-3-yl)piperidine-2,4-dione?
The canonical SMILES for 1-(3-methyl-1,1-dioxothiolan-3-yl)piperidine-2,4-dione is CC1(N2CCC(=O)CC2=O)CCS(=O)(=O)C1.
What is the InChIKey of 1-(3-methyl-1,1-dioxothiolan-3-yl)piperidine-2,4-dione?
The InChIKey is XJVODDSUQHVILW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO4S/c1-10(3-5-16(14,15)7-10)11-4-2-8(12)6-9(11)13/h2-7H2,1H3.
What are the key properties of 1-(3-methyl-1,1-dioxothiolan-3-yl)piperidine-2,4-dione?
1-(3-methyl-1,1-dioxothiolan-3-yl)piperidine-2,4-dione has a molecular weight of 245.30 g/mol, XLogP of -0.24, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methyl-1,1-dioxothiolan-3-yl)piperidine-2,4-dione is sourced from PubChem (CID 79515274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).